ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
19056-40-7 4-Bromo-3-methoxyaniline |
|
Ürün Adı | 4-Bromo-3-methoxyaniline |
ingilizce adı | 4-Bromo-3-methoxyaniline;4-Bromo-m-anisidine;4-nitrophenyl 2-aminobenzoate;4-Bromo-3-Methoxy-Phenylamine;5-Amino-2-bromoanisole |
Moleküler Formülü | C13H10N2O4 |
Molekül Ağırlığı | 258.2295 |
InChI | InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
CAS kayıt numarası | 19056-40-7 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.381g/cm3 |
Kaynama noktası | 467°C at 760 mmHg |
Kırılma indisi | 1.655 |
Alevlenme noktası | 236.2°C |
Buhar basıncı | 6.74E-09mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |