ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
19056-40-7 4-Bromo-3-methoxyaniline |
|
उत्पाद का नाम | 4-Bromo-3-methoxyaniline |
अंग्रेज | 4-Bromo-3-methoxyaniline;4-Bromo-m-anisidine;4-nitrophenyl 2-aminobenzoate;4-Bromo-3-Methoxy-Phenylamine;5-Amino-2-bromoanisole |
आणविक फार्मूला | C13H10N2O4 |
आण्विक वजन | 258.2295 |
InChI | InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
कैस रजिस्टी संख्या | 19056-40-7 |
आणविक संरचना | ![]() |
घनत्व | 1.381g/cm3 |
उबलने का समय | 467°C at 760 mmHg |
अपवर्तक सूचकांक | 1.655 |
फ्लैश प्वाइंट | 236.2°C |
वाष्प का दबाव | 6.74E-09mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |