ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26547-51-3 8-Phenyloctanoic acid |
|
termék neve | 8-Phenyloctanoic acid |
Angol név | 8-Phenyloctanoic acid;8-phenyloctanoate;8-Phenyl-1-octanoic acid |
MF | C14H19O2 |
Molekulatömeg | 219.3 |
InChI | InChI=1/C14H20O2/c15-14(16)12-8-3-1-2-5-9-13-10-6-4-7-11-13/h4,6-7,10-11H,1-3,5,8-9,12H2,(H,15,16)/p-1 |
CAS-szám | 26547-51-3 |
Molekuláris szerkezete | ![]() |
Forráspont | 369.9°C at 760 mmHg |
Gyulladáspont | 266.9°C |
Gőznyomás | 3.98E-06mmHg at 25°C |
Kockázatot kódok | R36/38##Irritating to eyes and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |