ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26547-51-3 8-Phenyloctanoic acid |
|
उत्पाद का नाम | 8-Phenyloctanoic acid |
अंग्रेज | 8-Phenyloctanoic acid;8-phenyloctanoate;8-Phenyl-1-octanoic acid |
आणविक फार्मूला | C14H19O2 |
आण्विक वजन | 219.3 |
InChI | InChI=1/C14H20O2/c15-14(16)12-8-3-1-2-5-9-13-10-6-4-7-11-13/h4,6-7,10-11H,1-3,5,8-9,12H2,(H,15,16)/p-1 |
कैस रजिस्टी संख्या | 26547-51-3 |
आणविक संरचना | ![]() |
उबलने का समय | 369.9°C at 760 mmHg |
फ्लैश प्वाइंट | 266.9°C |
वाष्प का दबाव | 3.98E-06mmHg at 25°C |
खतरे के कोड | R36/38##Irritating to eyes and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |