ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26547-51-3 8-Phenyloctanoic acid |
|
상품명칭 | 8-Phenyloctanoic acid |
영문 이름 | 8-Phenyloctanoic acid;8-phenyloctanoate;8-Phenyl-1-octanoic acid |
분자식 | C14H19O2 |
분자량 | 219.3 |
InChI | InChI=1/C14H20O2/c15-14(16)12-8-3-1-2-5-9-13-10-6-4-7-11-13/h4,6-7,10-11H,1-3,5,8-9,12H2,(H,15,16)/p-1 |
cas번호 | 26547-51-3 |
분자 구조 | ![]() |
비등점 | 369.9°C at 760 mmHg |
인화점 | 266.9°C |
증기압 | 3.98E-06mmHg at 25°C |
리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |