ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
349-01-9 2,4-dinitro-5-fluorotoluene | 
    |
| termék neve | 2,4-dinitro-5-fluorotoluene | 
| Angol név | 2,4-dinitro-5-fluorotoluene;1-Fluoro-5-methyl-2,4-dinitrobenzene | 
| MF | C7H5FN2O4 | 
| Molekulatömeg | 200.124 | 
| InChI | InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 | 
| CAS-szám | 349-01-9 | 
| Molekuláris szerkezete | ![]()  | 
    
| Sűrűség | 1.497g/cm3 | 
| Olvadáspont | 82℃ | 
| Forráspont | 319°C at 760 mmHg | 
| Törésmutató | 1.575 | 
| Gyulladáspont | 146.8°C | 
| Gőznyomás | 0.000649mmHg at 25°C | 
| Veszély szimbólumok | |
| Kockázatot kódok | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; | 
    
| Biztonsági Leírás | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
    
| MSDS | |