ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
349-01-9 2,4-dinitro-5-fluorotoluene |
|
| produktnavn | 2,4-dinitro-5-fluorotoluene |
| Engelsk navn | 2,4-dinitro-5-fluorotoluene;1-Fluoro-5-methyl-2,4-dinitrobenzene |
| Molekylær Formel | C7H5FN2O4 |
| Molekylvekt | 200.124 |
| InChI | InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| CAS-nummer | 349-01-9 |
| Molecular Structure | ![]() |
| Tetthet | 1.497g/cm3 |
| Smeltepunkt | 82℃ |
| Kokepunkt | 319°C at 760 mmHg |
| Brytningsindeks | 1.575 |
| Flammepunktet | 146.8°C |
| Damptrykk | 0.000649mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| Sikkerhet Beskrivelse | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |