ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
349-01-9 2,4-dinitro-5-fluorotoluene |
|
| 상품명칭 | 2,4-dinitro-5-fluorotoluene |
| 영문 이름 | 2,4-dinitro-5-fluorotoluene;1-Fluoro-5-methyl-2,4-dinitrobenzene |
| 분자식 | C7H5FN2O4 |
| 분자량 | 200.124 |
| InChI | InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| cas번호 | 349-01-9 |
| 분자 구조 | ![]() |
| 밀도 | 1.497g/cm3 |
| 녹는 점 | 82℃ |
| 비등점 | 319°C at 760 mmHg |
| 굴절 지수 | 1.575 |
| 인화점 | 146.8°C |
| 증기압 | 0.000649mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |