ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
480-22-8 1,8,9-trihidroxi-antracén |
|
termék neve | 1,8,9-trihidroxi-antracén |
Szinonimák | ; 1,8,9-antracéntriol; 1,8-dihidroxiantrón; |
Angol név | 1,8,9-trihydroxyanthracene;1,8,9-Anthracenetriol;1,8-dihydroxyanthrone |
MF | C14H10O3 |
Molekulatömeg | 226.23 |
InChI | InChI=1/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-7,15-17H |
CAS-szám | 480-22-8 |
Molekuláris szerkezete | ![]() |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |