ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
480-22-8 1,8,9-트리하이드록시안트라센 |
|
상품명칭 | 1,8,9-트리하이드록시안트라센 |
별명 | ; 1,8,9-안트라세네트리올; 1,8-디히드록시안쓰론; |
영문 이름 | 1,8,9-trihydroxyanthracene;1,8,9-Anthracenetriol;1,8-dihydroxyanthrone |
분자식 | C14H10O3 |
분자량 | 226.23 |
InChI | InChI=1/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-7,15-17H |
cas번호 | 480-22-8 |
분자 구조 | ![]() |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |