ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
480-22-8 1،8،9-trihydroxyanthracene؛ ؛ 1،8،9-انتراسنتریول؛ 1.8-دی هیدروکسیانترون؛ |
|
نام محصول | 1،8،9-trihydroxyanthracene؛ ؛ 1،8،9-انتراسنتریول؛ 1.8-دی هیدروکسیانترون؛ |
نام انگلیسی | 1,8,9-trihydroxyanthracene;1,8,9-Anthracenetriol;1,8-dihydroxyanthrone |
میدان مغناطیسی | C14H10O3 |
وزن مولکولی | 226.23 |
InChI | InChI=1/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-7,15-17H |
شماره سیایاس | 480-22-8 |
ساختار مولکولی | ![]() |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |