ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175278-41-8 3- (3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl) asam akrilat |
|
Nama produk | 3- (3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl) asam akrilat |
Sinonim | (2E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enoic asam; |
Nama bahasa Inggris | 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid;(2E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enoic acid |
MF | C13H14N2O4 |
Berat Molekul | 262.2613 |
InChI | InChI=1/C13H14N2O4/c16-13(17)6-4-10-3-5-11(12(9-10)15(18)19)14-7-1-2-8-14/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-4+ |
CAS NO | 175278-41-8 |
Struktur Molekul | ![]() |
Kepadatan | 1.37g/cm3 |
Titik lebur | 243℃ |
Titik didih | 483.9°C at 760 mmHg |
Indeks bias | 1.657 |
Titik nyala | 246.5°C |
Tekanan uap | 3.54E-10mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |