ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175278-41-8 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylfenyl)akrylsyre |
|
produktnavn | 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylfenyl)akrylsyre |
Synonymer | (2E)-3-(3-nitro-4-pyrrolidin-1-ylfenyl)prop-2-ensyre; |
Engelsk navn | 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid;(2E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enoic acid |
Molekylær Formel | C13H14N2O4 |
Molekylvekt | 262.2613 |
InChI | InChI=1/C13H14N2O4/c16-13(17)6-4-10-3-5-11(12(9-10)15(18)19)14-7-1-2-8-14/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-4+ |
CAS-nummer | 175278-41-8 |
Molecular Structure | ![]() |
Tetthet | 1.37g/cm3 |
Smeltepunkt | 243℃ |
Kokepunkt | 483.9°C at 760 mmHg |
Brytningsindeks | 1.657 |
Flammepunktet | 246.5°C |
Damptrykk | 3.54E-10mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |