ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175278-41-8 3-(3-니트로-4-테트라하이드로-1H-피롤-1-일페닐)아크릴산 |
|
상품명칭 | 3-(3-니트로-4-테트라하이드로-1H-피롤-1-일페닐)아크릴산 |
별명 | (2E)-3-(3-니트로-4-피롤리딘-1-일페닐)프로프-2-에노산; |
영문 이름 | 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid;(2E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enoic acid |
분자식 | C13H14N2O4 |
분자량 | 262.2613 |
InChI | InChI=1/C13H14N2O4/c16-13(17)6-4-10-3-5-11(12(9-10)15(18)19)14-7-1-2-8-14/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-4+ |
cas번호 | 175278-41-8 |
분자 구조 | ![]() |
밀도 | 1.37g/cm3 |
녹는 점 | 243℃ |
비등점 | 483.9°C at 760 mmHg |
굴절 지수 | 1.657 |
인화점 | 246.5°C |
증기압 | 3.54E-10mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |