ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
203436-48-0 4- (2-thienyl) benzylamine |
|
| Nama produk | 4- (2-thienyl) benzylamine |
| Sinonim | 1- (4-thiophen-2-ylphenyl) methanamine; 4- (1,3-oksazol-5-yl) asam benzoat; |
| Nama bahasa Inggris | 4-(2-thienyl)benzylamine;1-(4-thiophen-2-ylphenyl)methanamine;4-(1,3-oxazol-5-yl)benzoic acid |
| MF | C10H7NO3 |
| Berat Molekul | 189.1675 |
| InChI | InChI=1/C10H7NO3/c12-10(13)8-3-1-7(2-4-8)9-5-11-6-14-9/h1-6H,(H,12,13) |
| CAS NO | 203436-48-0 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.32g/cm3 |
| Titik didih | 390.3°C at 760 mmHg |
| Indeks bias | 1.587 |
| Titik nyala | 189.8°C |
| Tekanan uap | 8.62E-07mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R34##Causes burns.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |