ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
203436-48-0 4-(2-tienylo)benzyloamina |
|
| Nazwa produktu: | 4-(2-tienylo)benzyloamina |
| Synonimy | 1-(4-tiofen-2-ylofenylo)metanamina; kwas 4-(1,3-oksazol-5-ylo)benzoesowy; |
| Angielska nazwa | 4-(2-thienyl)benzylamine;1-(4-thiophen-2-ylphenyl)methanamine;4-(1,3-oxazol-5-yl)benzoic acid |
| MF | C10H7NO3 |
| Masie cząsteczkowej | 189.1675 |
| InChI | InChI=1/C10H7NO3/c12-10(13)8-3-1-7(2-4-8)9-5-11-6-14-9/h1-6H,(H,12,13) |
| Nr CAS | 203436-48-0 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.32g/cm3 |
| Temperatura wrzenia | 390.3°C at 760 mmHg |
| Współczynnik załamania | 1.587 |
| Temperatura zapłonu | 189.8°C |
| Ciśnienie pary | 8.62E-07mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R34##Causes burns.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |