ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
203436-48-0 4- (2-تینیل) بنزیلامین؛ 1- (4-تیوفن-2-یل فنیل) متانامین؛ 4- (1،3-اگزازول-5-ایل) بنزوئیک اسید؛ |
|
| نام محصول | 4- (2-تینیل) بنزیلامین؛ 1- (4-تیوفن-2-یل فنیل) متانامین؛ 4- (1،3-اگزازول-5-ایل) بنزوئیک اسید؛ |
| نام انگلیسی | 4-(2-thienyl)benzylamine;1-(4-thiophen-2-ylphenyl)methanamine;4-(1,3-oxazol-5-yl)benzoic acid |
| میدان مغناطیسی | C10H7NO3 |
| وزن مولکولی | 189.1675 |
| InChI | InChI=1/C10H7NO3/c12-10(13)8-3-1-7(2-4-8)9-5-11-6-14-9/h1-6H,(H,12,13) |
| شماره سیایاس | 203436-48-0 |
| ساختار مولکولی | ![]() |
| تراکم | 1.32g/cm3 |
| نقطه غلیان | 390.3°C at 760 mmHg |
| ضریب شکست | 1.587 |
| نقطه اشتعال | 189.8°C |
| فشار بخار | 8.62E-07mmHg at 25°C |
| خطر نمادها | |
| کدهای خطر | R34##Causes burns.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |