ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26351-19-9 Violuric acid monohydrate |
|
Nama produk | Violuric acid monohydrate |
Nama bahasa Inggris | Violuric acid monohydrate;Alloxan-5-oxime monohydrate;5-Isonitrosobarbituric acid monohydrate;5-(hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate (1:1) |
MF | C4H5N3O5 |
Berat Molekul | 175.0996 |
InChI | InChI=1/C4H3N3O4.H2O/c8-2-1(7-11)3(9)6-4(10)5-2;/h11H,(H2,5,6,8,9,10);1H2 |
CAS NO | 26351-19-9 |
EINECS | 201-741-4 |
Struktur Molekul | ![]() |
Titik lebur | 236-240℃ |
Titik didih | 449°C at 760 mmHg |
Titik nyala | 225.4°C |
Tekanan uap | 5.97E-10mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |