ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26351-19-9 Violuric acid monohydrate |
|
उत्पाद का नाम | Violuric acid monohydrate |
अंग्रेज | Violuric acid monohydrate;Alloxan-5-oxime monohydrate;5-Isonitrosobarbituric acid monohydrate;5-(hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate (1:1) |
आणविक फार्मूला | C4H5N3O5 |
आण्विक वजन | 175.0996 |
InChI | InChI=1/C4H3N3O4.H2O/c8-2-1(7-11)3(9)6-4(10)5-2;/h11H,(H2,5,6,8,9,10);1H2 |
कैस रजिस्टी संख्या | 26351-19-9 |
EINECS | 201-741-4 |
आणविक संरचना | ![]() |
गलनांक | 236-240℃ |
उबलने का समय | 449°C at 760 mmHg |
फ्लैश प्वाइंट | 225.4°C |
वाष्प का दबाव | 5.97E-10mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |