Chemindex > 26351-19-9
NL ▼
26351-19-9 Violuric acid monohydrate |
|
| Naam product | Violuric acid monohydrate |
| Engelse naam | Violuric acid monohydrate;Alloxan-5-oxime monohydrate;5-Isonitrosobarbituric acid monohydrate;5-(hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate (1:1) |
| MF | C4H5N3O5 |
| Molecuulgewicht | 175.0996 |
| InChI | InChI=1/C4H3N3O4.H2O/c8-2-1(7-11)3(9)6-4(10)5-2;/h11H,(H2,5,6,8,9,10);1H2 |
| CAS-nummer | 26351-19-9 |
| EINECS | 201-741-4 |
| Moleculaire Structuur |  |
| Smeltpunt | 236-240℃ |
| Kookpunt | 449°C at 760 mmHg |
| Vlampunt | 225.4°C |
| Dampdruk | 5.97E-10mmHg at 25°C |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 