ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5211-62-1 2-Methoxyphenylacetone |
|
Nama produk | 2-Methoxyphenylacetone |
Nama bahasa Inggris | 2-Methoxyphenylacetone;2-Methoxybenzyl methyl ketone;1-(2-Methoxyphenyl)-2-propanone;1-(2-methoxyphenyl)propan-2-one |
MF | C10H12O2 |
Berat Molekul | 164.2011 |
InChI | InChI=1/C10H12O2/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,7H2,1-2H3 |
CAS NO | 5211-62-1 |
EINECS | 226-008-6 |
Struktur Molekul | ![]() |
Kepadatan | 1.027g/cm3 |
Titik lebur | 127-130℃ (10 mmHg) |
Titik didih | 261.7°C at 760 mmHg |
Indeks bias | 1.501 |
Titik nyala | 94°C |
Tekanan uap | 0.0114mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |