ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5211-62-1 2-Methoxyphenylacetone |
|
Naam product | 2-Methoxyphenylacetone |
Engelse naam | 2-Methoxyphenylacetone;2-Methoxybenzyl methyl ketone;1-(2-Methoxyphenyl)-2-propanone;1-(2-methoxyphenyl)propan-2-one |
MF | C10H12O2 |
Molecuulgewicht | 164.2011 |
InChI | InChI=1/C10H12O2/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,7H2,1-2H3 |
CAS-nummer | 5211-62-1 |
EINECS | 226-008-6 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.027g/cm3 |
Smeltpunt | 127-130℃ (10 mmHg) |
Kookpunt | 261.7°C at 760 mmHg |
Brekingsindex | 1.501 |
Vlampunt | 94°C |
Dampdruk | 0.0114mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |