Chemindex > 5211-62-1
KR ▼
5211-62-1 2-Methoxyphenylacetone |
|
| 상품명칭 | 2-Methoxyphenylacetone |
| 영문 이름 | 2-Methoxyphenylacetone;2-Methoxybenzyl methyl ketone;1-(2-Methoxyphenyl)-2-propanone;1-(2-methoxyphenyl)propan-2-one |
| 분자식 | C10H12O2 |
| 분자량 | 164.2011 |
| InChI | InChI=1/C10H12O2/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,7H2,1-2H3 |
| cas번호 | 5211-62-1 |
| EC번호 | 226-008-6 |
| 분자 구조 |  |
| 밀도 | 1.027g/cm3 |
| 녹는 점 | 127-130℃ (10 mmHg) |
| 비등점 | 261.7°C at 760 mmHg |
| 굴절 지수 | 1.501 |
| 인화점 | 94°C |
| 증기압 | 0.0114mmHg at 25°C |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 