Chemindex > 59989-20-7
ID ▼
59989-20-7 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 6-amino-2-methylheptan-2-ol (1:1) |
|
| Nama produk | 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 6-amino-2-methylheptan-2-ol (1:1) |
| Nama bahasa Inggris | 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 6-amino-2-methylheptan-2-ol (1:1);theo-Hexanicit;7-Theophyllinessigsaeure-(6-amino-2-methyl-2-heptyl)-ester;Cariamyl;Corophylline;Heptaminol;Heptaminol etaphyllinate;Theo-Heptylon;1H-Purine-2,6-dione, 7-acetyl-3,7-dihydro-1,3-dimethyl-, compd with 6-amino-2-methyl-2-heptanol (1:1);2-Heptanol, 6-amino-2-methyl-, compd with 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione (1:1);(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)acetic acid - 6-amino-2-methylheptan-2-ol (1:1);7-acetyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 6-amino-2-methylheptan-2-ol (1:1) |
| MF | C17H29N5O4 |
| Berat Molekul | 367.4433 |
| InChI | InChI=1/C9H10N4O3.C8H19NO/c1-5(14)13-4-10-7-6(13)8(15)12(3)9(16)11(7)2;1-7(9)5-4-6-8(2,3)10/h4H,1-3H3;7,10H,4-6,9H2,1-3H3 |
| CAS NO | 59989-20-7 |
| EINECS | 262-012-4 |
| Struktur Molekul |  |
| Titik didih | 429.9°C at 760 mmHg |
| Titik nyala | 213.8°C |
| Tekanan uap | 1.35E-07mmHg at 25°C |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Pemasok seharga 59989-20-7 (0):
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 