Chemindex >59989-20-7
MY ▼
59989-20-7 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 6-amino-2-methylheptan-2-ol (1:1) |
|
| Nama produk | 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 6-amino-2-methylheptan-2-ol (1:1) |
| Nama Inggeris | 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 6-amino-2-methylheptan-2-ol (1:1);theo-Hexanicit;7-Theophyllinessigsaeure-(6-amino-2-methyl-2-heptyl)-ester;Cariamyl;Corophylline;Heptaminol;Heptaminol etaphyllinate;Theo-Heptylon;1H-Purine-2,6-dione, 7-acetyl-3,7-dihydro-1,3-dimethyl-, compd with 6-amino-2-methyl-2-heptanol (1:1);2-Heptanol, 6-amino-2-methyl-, compd with 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione (1:1);(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)acetic acid - 6-amino-2-methylheptan-2-ol (1:1);7-acetyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 6-amino-2-methylheptan-2-ol (1:1) |
| MF | C17H29N5O4 |
| Berat Molekul | 367.4433 |
| InChI | InChI=1/C9H10N4O3.C8H19NO/c1-5(14)13-4-10-7-6(13)8(15)12(3)9(16)11(7)2;1-7(9)5-4-6-8(2,3)10/h4H,1-3H3;7,10H,4-6,9H2,1-3H3 |
| CAS NO | 59989-20-7 |
| EINECS | 262-012-4 |
| Struktur Molekul |  |
| Titik didih | 429.9°C at 760 mmHg |
| Titik nyala | 213.8°C |
| Tekanan wap | 1.35E-07mmHg at 25°C |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 59989-20-7 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 