Chemindex > 59989-20-7
IN ▼
59989-20-7 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 6-amino-2-methylheptan-2-ol (1:1) |
|
| उत्पाद का नाम | 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 6-amino-2-methylheptan-2-ol (1:1) |
| अंग्रेज | 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 6-amino-2-methylheptan-2-ol (1:1);theo-Hexanicit;7-Theophyllinessigsaeure-(6-amino-2-methyl-2-heptyl)-ester;Cariamyl;Corophylline;Heptaminol;Heptaminol etaphyllinate;Theo-Heptylon;1H-Purine-2,6-dione, 7-acetyl-3,7-dihydro-1,3-dimethyl-, compd with 6-amino-2-methyl-2-heptanol (1:1);2-Heptanol, 6-amino-2-methyl-, compd with 7-acetyl-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione (1:1);(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)acetic acid - 6-amino-2-methylheptan-2-ol (1:1);7-acetyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 6-amino-2-methylheptan-2-ol (1:1) |
| आणविक फार्मूला | C17H29N5O4 |
| आण्विक वजन | 367.4433 |
| InChI | InChI=1/C9H10N4O3.C8H19NO/c1-5(14)13-4-10-7-6(13)8(15)12(3)9(16)11(7)2;1-7(9)5-4-6-8(2,3)10/h4H,1-3H3;7,10H,4-6,9H2,1-3H3 |
| कैस रजिस्टी संख्या | 59989-20-7 |
| EINECS | 262-012-4 |
| आणविक संरचना |  |
| उबलने का समय | 429.9°C at 760 mmHg |
| फ्लैश प्वाइंट | 213.8°C |
| वाष्प का दबाव | 1.35E-07mmHg at 25°C |
| MSDS | |
- यदि आप चीन से रसायन प्राप्त करने की योजना बना रहे हैं, तो बस जाएं केमनेट मॉल, हम आपके लिए चीन के निर्माताओं से नवीनतम और प्रतिस्पर्धी मूल्य प्राप्त करेंगे।कृपया ChemNet Mall पर जाएं
59989-20-7 (0) के लिए आपूर्तिकर्ता:
रासायनिक सीएएस डेटाबेस सेवा ChemIndex.com द् 