ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-19-3 metil 2-etilheksanoat |
|
| Nama produk | metil 2-etilheksanoat |
| Sinonim | Asam heksanoat, 2-etil-, metil ester; AI3-33653; Metil 2-etilheksanoat |
| Nama bahasa Inggris | methyl 2-ethylhexanoate;Hexanoic acid, 2-ethyl-, methyl ester;AI3-33653;Methyl 2-ethylhexanoate |
| MF | C9H18O2 |
| Berat Molekul | 158.238 |
| InChI | InChI=1/C9H18O2/c1-4-6-7-8(5-2)9(10)11-3/h8H,4-7H2,1-3H3 |
| CAS NO | 816-19-3 |
| EINECS | 212-429-2 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.874g/cm3 |
| Titik didih | 176.5°C at 760 mmHg |
| Indeks bias | 1.416 |
| Titik nyala | 59.4°C |
| Tekanan uap | 1.09mmHg at 25°C |
| MSDS | |