ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-19-3 methyl-2-ethylhexanoaat |
|
| Naam product | methyl-2-ethylhexanoaat |
| Synoniemen | Hexaanzuur, 2-ethyl-, methylester; AI3-33653; Methyl-2-ethylhexanoaat |
| Engelse naam | methyl 2-ethylhexanoate;Hexanoic acid, 2-ethyl-, methyl ester;AI3-33653;Methyl 2-ethylhexanoate |
| MF | C9H18O2 |
| Molecuulgewicht | 158.238 |
| InChI | InChI=1/C9H18O2/c1-4-6-7-8(5-2)9(10)11-3/h8H,4-7H2,1-3H3 |
| CAS-nummer | 816-19-3 |
| EINECS | 212-429-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.874g/cm3 |
| Kookpunt | 176.5°C at 760 mmHg |
| Brekingsindex | 1.416 |
| Vlampunt | 59.4°C |
| Dampdruk | 1.09mmHg at 25°C |
| MSDS | |