ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-21-4 4-Chloro-2-nitroanisole |
|
| Nama produk | 4-Chloro-2-nitroanisole |
| Nama bahasa Inggris | 4-Chloro-2-nitroanisole;AI3-01524;Benzene, 4-chloro-1-methoxy-2-nitro-;4-chloro-1-methoxy-2-nitrobenzene |
| MF | C7H6ClNO3 |
| Berat Molekul | 187.5804 |
| InChI | InChI=1/C7H6ClNO3/c1-12-7-3-2-5(8)4-6(7)9(10)11/h2-4H,1H3 |
| CAS NO | 89-21-4 |
| EINECS | 201-887-9 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.366g/cm3 |
| Titik didih | 279.6°C at 760 mmHg |
| Indeks bias | 1.559 |
| Titik nyala | 122.9°C |
| Tekanan uap | 0.00675mmHg at 25°C |
| MSDS | |