ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-21-4 4-Chloro-2-nitroanisole |
|
| 상품명칭 | 4-Chloro-2-nitroanisole |
| 영문 이름 | 4-Chloro-2-nitroanisole;AI3-01524;Benzene, 4-chloro-1-methoxy-2-nitro-;4-chloro-1-methoxy-2-nitrobenzene |
| 분자식 | C7H6ClNO3 |
| 분자량 | 187.5804 |
| InChI | InChI=1/C7H6ClNO3/c1-12-7-3-2-5(8)4-6(7)9(10)11/h2-4H,1H3 |
| cas번호 | 89-21-4 |
| EC번호 | 201-887-9 |
| 분자 구조 | ![]() |
| 밀도 | 1.366g/cm3 |
| 비등점 | 279.6°C at 760 mmHg |
| 굴절 지수 | 1.559 |
| 인화점 | 122.9°C |
| 증기압 | 0.00675mmHg at 25°C |
| MSDS | |