ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-21-4 4-Chloro-2-nitroanisole |
|
| Nome do produto | 4-Chloro-2-nitroanisole |
| Nome em inglês | 4-Chloro-2-nitroanisole;AI3-01524;Benzene, 4-chloro-1-methoxy-2-nitro-;4-chloro-1-methoxy-2-nitrobenzene |
| Fórmula molecular | C7H6ClNO3 |
| Peso Molecular | 187.5804 |
| InChI | InChI=1/C7H6ClNO3/c1-12-7-3-2-5(8)4-6(7)9(10)11/h2-4H,1H3 |
| CAS Registry Number | 89-21-4 |
| EINECS | 201-887-9 |
| Estrutura Molecular | ![]() |
| Densidade | 1.366g/cm3 |
| Ponto de ebulição | 279.6°C at 760 mmHg |
| índice de refração | 1.559 |
| O ponto de inflamação | 122.9°C |
| Pressão de vapor | 0.00675mmHg at 25°C |
| MSDS | |