ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
92-24-0 2,3-Benzanthracene |
|
| Nama produk | 2,3-Benzanthracene |
| Nama bahasa Inggris | 2,3-Benzanthracene;NAPHTHACENE;Chrysogen;LT-S940;Tetracene |
| MF | C18H12 |
| Berat Molekul | 228.2879 |
| InChI | InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| CAS NO | 92-24-0 |
| EINECS | 202-138-9 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.19g/cm3 |
| Titik lebur | 300℃ |
| Titik didih | 436.7°C at 760 mmHg |
| Indeks bias | 1.771 |
| Titik nyala | 209.1°C |
| Tekanan uap | 2.02E-07mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R40##Possible risks of irreversible effects.:; |
| Keselamatan Deskripsi | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |