Chemindex > 92-24-0
KR ▼
92-24-0 2,3-Benzanthracene |
|
| 상품명칭 | 2,3-Benzanthracene |
| 영문 이름 | 2,3-Benzanthracene;NAPHTHACENE;Chrysogen;LT-S940;Tetracene |
| 분자식 | C18H12 |
| 분자량 | 228.2879 |
| InChI | InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| cas번호 | 92-24-0 |
| EC번호 | 202-138-9 |
| 분자 구조 |  |
| 밀도 | 1.19g/cm3 |
| 녹는 점 | 300℃ |
| 비등점 | 436.7°C at 760 mmHg |
| 굴절 지수 | 1.771 |
| 인화점 | 209.1°C |
| 증기압 | 2.02E-07mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R40##Possible risks of irreversible effects.:; |
| 보안 규칙 | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 