ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
92-24-0 2,3-Benzanthracene |
|
| Nome do produto | 2,3-Benzanthracene |
| Nome em inglês | 2,3-Benzanthracene;NAPHTHACENE;Chrysogen;LT-S940;Tetracene |
| Fórmula molecular | C18H12 |
| Peso Molecular | 228.2879 |
| InChI | InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| CAS Registry Number | 92-24-0 |
| EINECS | 202-138-9 |
| Estrutura Molecular | ![]() |
| Densidade | 1.19g/cm3 |
| Ponto de fusão | 300℃ |
| Ponto de ebulição | 436.7°C at 760 mmHg |
| índice de refração | 1.771 |
| O ponto de inflamação | 209.1°C |
| Pressão de vapor | 2.02E-07mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R40##Possible risks of irreversible effects.:; |
| Descrição da Segurança | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |