Chemindex > 3385-21-5
IL ▼
3385-21-5 cyclohex-1,3-ylenediamine |
|
| שם המוצר | cyclohex-1,3-ylenediamine |
| שם אנגלי | cyclohex-1,3-ylenediamine;1,3-Diaminocyclohexane, mixture of isomers;1,3-Cyclohexanediamine (cis- and trans- mixture);1,3-Cyclohexanediamine;cyclohexane-1,3-diamine;(1R,3S)-cyclohexane-1,3-diaminium;(1R,3R)-cyclohexane-1,3-diaminium;(1S,3S)-cyclohexane-1,3-diaminium;1,3-Diaminocyclohexane |
| מולקולרית פורמולה | C6H16N2 |
| משקל מולקולרי | 116.2035 |
| InChl | InChI=1/C6H14N2/c7-5-2-1-3-6(8)4-5/h5-6H,1-4,7-8H2/p+2/t5-,6-/m0/s1 |
| מספר CAS | 3385-21-5 |
| EINECS | 222-194-8 |
| מבנה מולקולרי |  |
| נקודת רתיחה | 191.1°C at 760 mmHg |
| נקודת הבזק | 79.4°C |
| לחץ אדים | 0.525mmHg at 25°C |
| Hazard סימנים |  C##Corrosive:; |
| סיכונים קודי | R20/21/22||R34:; |
| בטיחות תיאור | S26||S36/37/39||S45:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
שירות מסד הנתונים של CAS כימי מסופק ע& 