Chemindex > 3385-21-5
KR ▼
3385-21-5 cyclohex-1,3-ylenediamine |
|
| 상품명칭 | cyclohex-1,3-ylenediamine |
| 영문 이름 | cyclohex-1,3-ylenediamine;1,3-Diaminocyclohexane, mixture of isomers;1,3-Cyclohexanediamine (cis- and trans- mixture);1,3-Cyclohexanediamine;cyclohexane-1,3-diamine;(1R,3S)-cyclohexane-1,3-diaminium;(1R,3R)-cyclohexane-1,3-diaminium;(1S,3S)-cyclohexane-1,3-diaminium;1,3-Diaminocyclohexane |
| 분자식 | C6H16N2 |
| 분자량 | 116.2035 |
| InChI | InChI=1/C6H14N2/c7-5-2-1-3-6(8)4-5/h5-6H,1-4,7-8H2/p+2/t5-,6-/m0/s1 |
| cas번호 | 3385-21-5 |
| EC번호 | 222-194-8 |
| 분자 구조 |  |
| 비등점 | 191.1°C at 760 mmHg |
| 인화점 | 79.4°C |
| 증기압 | 0.525mmHg at 25°C |
| 위험성 표시 |  C##Corrosive:; |
| 리스크 규칙 | R20/21/22||R34:; |
| 보안 규칙 | S26||S36/37/39||S45:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 