ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3385-21-5 cyclohex-1,3-ylenediamine |
|
उत्पाद का नाम | cyclohex-1,3-ylenediamine |
अंग्रेज | cyclohex-1,3-ylenediamine;1,3-Diaminocyclohexane, mixture of isomers;1,3-Cyclohexanediamine (cis- and trans- mixture);1,3-Cyclohexanediamine;cyclohexane-1,3-diamine;(1R,3S)-cyclohexane-1,3-diaminium;(1R,3R)-cyclohexane-1,3-diaminium;(1S,3S)-cyclohexane-1,3-diaminium;1,3-Diaminocyclohexane |
आणविक फार्मूला | C6H16N2 |
आण्विक वजन | 116.2035 |
InChI | InChI=1/C6H14N2/c7-5-2-1-3-6(8)4-5/h5-6H,1-4,7-8H2/p+2/t5-,6-/m0/s1 |
कैस रजिस्टी संख्या | 3385-21-5 |
EINECS | 222-194-8 |
आणविक संरचना | ![]() |
उबलने का समय | 191.1°C at 760 mmHg |
फ्लैश प्वाइंट | 79.4°C |
वाष्प का दबाव | 0.525mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R20/21/22||R34:; |
सुरक्षा विवरण | S26||S36/37/39||S45:; |
MSDS |