ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-13-8 2-Aminoanthracene |
|
| שם המוצר | 2-Aminoanthracene |
| שם אנגלי | 2-Aminoanthracene;2-anthramine practical grade*crystalline;2-anthrylamine;2-Anthramine;2-Anthranamine;anthracen-2-amine;2-Anthracenamide; |
| מולקולרית פורמולה | C14H11N |
| משקל מולקולרי | 193.2438 |
| InChl | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
| מספר CAS | 613-13-8 |
| EINECS | 210-330-9 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.208g/cm3 |
| נקודת ההתוך | 238-241℃ |
| נקודת רתיחה | 414.2°C at 760 mmHg |
| משקל סגולי | 1.765 |
| נקודת הבזק | 229°C |
| לחץ אדים | 4.52E-07mmHg at 25°C |
| Hazard סימנים | |
| סיכונים קודי | R33##Danger of cummulative effects.:; |
| בטיחות תיאור | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |