ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-13-8 2-Aminoanthracene |
|
| نام محصول | 2-Aminoanthracene |
| نام انگلیسی | 2-Aminoanthracene;2-anthramine practical grade*crystalline;2-anthrylamine;2-Anthramine;2-Anthranamine;anthracen-2-amine;2-Anthracenamide; |
| میدان مغناطیسی | C14H11N |
| وزن مولکولی | 193.2438 |
| InChI | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
| شماره سیایاس | 613-13-8 |
| تعداد کمیسیون اروپایی | 210-330-9 |
| ساختار مولکولی | ![]() |
| تراکم | 1.208g/cm3 |
| نقطه ذوب | 238-241℃ |
| نقطه غلیان | 414.2°C at 760 mmHg |
| ضریب شکست | 1.765 |
| نقطه اشتعال | 229°C |
| فشار بخار | 4.52E-07mmHg at 25°C |
| خطر نمادها | |
| کدهای خطر | R33##Danger of cummulative effects.:; |
| توضیحات ایمنی | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |