ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-13-8 2-Aminoanthracene |
|
| Nazwa produktu: | 2-Aminoanthracene |
| Angielska nazwa | 2-Aminoanthracene;2-anthramine practical grade*crystalline;2-anthrylamine;2-Anthramine;2-Anthranamine;anthracen-2-amine;2-Anthracenamide; |
| MF | C14H11N |
| Masie cząsteczkowej | 193.2438 |
| InChI | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
| Nr CAS | 613-13-8 |
| EINECS | 210-330-9 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.208g/cm3 |
| Temperatura topnienia | 238-241℃ |
| Temperatura wrzenia | 414.2°C at 760 mmHg |
| Współczynnik załamania | 1.765 |
| Temperatura zapłonu | 229°C |
| Ciśnienie pary | 4.52E-07mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R33##Danger of cummulative effects.:; |
| Bezpieczeństwo opis | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |