ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
157911-56-3 2,4,5-trifluorobenzyl bromide |
|
उत्पाद का नाम | 2,4,5-trifluorobenzyl bromide |
अंग्रेज | 2,4,5-trifluorobenzyl bromide;alpha-Bromo-2,4,5-trifluorotoluene;(3,3,3-trifluoropropyl)benzene;1-(bromomethyl)-2,4,5-trifluorobenzene |
आणविक फार्मूला | C7H4BrF3 |
आण्विक वजन | 225.0059 |
InChI | InChI=1/C7H4BrF3/c8-3-4-1-6(10)7(11)2-5(4)9/h1-2H,3H2 |
कैस रजिस्टी संख्या | 157911-56-3 |
आणविक संरचना | ![]() |
घनत्व | 1.71g/cm3 |
उबलने का समय | 188.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.502 |
फ्लैश प्वाइंट | 75.4°C |
वाष्प का दबाव | 0.814mmHg at 25°C |
खतरे के कोड | R34##Causes burns.||R36##Irritating to eyes.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |