ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
157911-56-3 2,4,5-trifluorobenzyl bromide |
|
Nazwa produktu: | 2,4,5-trifluorobenzyl bromide |
Angielska nazwa | 2,4,5-trifluorobenzyl bromide;alpha-Bromo-2,4,5-trifluorotoluene;(3,3,3-trifluoropropyl)benzene;1-(bromomethyl)-2,4,5-trifluorobenzene |
MF | C7H4BrF3 |
Masie cząsteczkowej | 225.0059 |
InChI | InChI=1/C7H4BrF3/c8-3-4-1-6(10)7(11)2-5(4)9/h1-2H,3H2 |
Nr CAS | 157911-56-3 |
Struktury molekularnej | ![]() |
Gęstość | 1.71g/cm3 |
Temperatura wrzenia | 188.8°C at 760 mmHg |
Współczynnik załamania | 1.502 |
Temperatura zapłonu | 75.4°C |
Ciśnienie pary | 0.814mmHg at 25°C |
Kody ryzyka | R34##Causes burns.||R36##Irritating to eyes.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |