ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
157911-56-3 2,4,5-trifluorobenzyl bromide |
|
اسم المنتج | 2,4,5-trifluorobenzyl bromide |
الاسم بالانجليزية | 2,4,5-trifluorobenzyl bromide;alpha-Bromo-2,4,5-trifluorotoluene;(3,3,3-trifluoropropyl)benzene;1-(bromomethyl)-2,4,5-trifluorobenzene |
الصيغة الجزيئية | C7H4BrF3 |
الوزن الجزيئي الغرامي | 225.0059 |
InChI | InChI=1/C7H4BrF3/c8-3-4-1-6(10)7(11)2-5(4)9/h1-2H,3H2 |
إستراتيجية المساعدة القطرية | 157911-56-3 |
بنية جزيئية | ![]() |
كثافة | 1.71g/cm3 |
نقطة الغليان | 188.8°C at 760 mmHg |
معامل الإنكسار | 1.502 |
نقطة الوميض | 75.4°C |
ضغط البخار | 0.814mmHg at 25°C |
خطر المصطلحات | R34##Causes burns.||R36##Irritating to eyes.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |