ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25153-40-6 Methyl vinyl ether/maleic acid copolymer |
|
उत्पाद का नाम | Methyl vinyl ether/maleic acid copolymer |
अंग्रेज | Methyl vinyl ether/maleic acid copolymer;Poly(methyl vinyl ether-alt-maleic acid);methoxyethene-(2Z)-but-2-enedioic acid (1:1);poly(methyl vinyl ether/maleic acid)copolymer;Poly( methyl vinyl ether/maleic acid)copolymer (PP series) |
आणविक फार्मूला | C7H10O5 |
आण्विक वजन | 174.1513 |
InChI | InChI=1/C4H4O4.C3H6O/c5-3(6)1-2-4(7)8;1-3-4-2/h1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2-1-; |
कैस रजिस्टी संख्या | 25153-40-6 |
आणविक संरचना | ![]() |
उबलने का समय | 355.5°C at 760 mmHg |
फ्लैश प्वाइंट | 183°C |
वाष्प का दबाव | 5.19E-06mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |