Chemindex > 25153-40-6
KR ▼
25153-40-6 Methyl vinyl ether/maleic acid copolymer |
|
| 상품명칭 | Methyl vinyl ether/maleic acid copolymer |
| 영문 이름 | Methyl vinyl ether/maleic acid copolymer;Poly(methyl vinyl ether-alt-maleic acid);methoxyethene-(2Z)-but-2-enedioic acid (1:1);poly(methyl vinyl ether/maleic acid)copolymer;Poly( methyl vinyl ether/maleic acid）copolymer (PP series) |
| 분자식 | C7H10O5 |
| 분자량 | 174.1513 |
| InChI | InChI=1/C4H4O4.C3H6O/c5-3(6)1-2-4(7)8;1-3-4-2/h1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2-1-; |
| cas번호 | 25153-40-6 |
| 분자 구조 |  |
| 비등점 | 355.5°C at 760 mmHg |
| 인화점 | 183°C |
| 증기압 | 5.19E-06mmHg at 25°C |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 