ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25153-40-6 Methyl vinyl ether/maleic acid copolymer |
|
اسم المنتج | Methyl vinyl ether/maleic acid copolymer |
الاسم بالانجليزية | Methyl vinyl ether/maleic acid copolymer;Poly(methyl vinyl ether-alt-maleic acid);methoxyethene-(2Z)-but-2-enedioic acid (1:1);poly(methyl vinyl ether/maleic acid)copolymer;Poly( methyl vinyl ether/maleic acid)copolymer (PP series) |
الصيغة الجزيئية | C7H10O5 |
الوزن الجزيئي الغرامي | 174.1513 |
InChI | InChI=1/C4H4O4.C3H6O/c5-3(6)1-2-4(7)8;1-3-4-2/h1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2-1-; |
إستراتيجية المساعدة القطرية | 25153-40-6 |
بنية جزيئية | ![]() |
نقطة الغليان | 355.5°C at 760 mmHg |
نقطة الوميض | 183°C |
ضغط البخار | 5.19E-06mmHg at 25°C |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |