ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 617-05-0 Vanilicacidethylester; 97% | |
| نام محصول | Vanilicacidethylester; 97% | 
| نام انگلیسی | Vanilicacidethylester; 97%;Vanilic acid ethyl ester;Ethyl vanillate;Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester;4-Hydroxy-3-methoxybenzoic acid ethyl ester;ethyl 4-hydroxy-3-methoxybenzoate | 
| میدان مغناطیسی | C10H12O4 | 
| وزن مولکولی | 196.1999 | 
| InChI | InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 | 
| شماره سیایاس | 617-05-0 | 
| تعداد کمیسیون اروپایی | 210-503-9 | 
| ساختار مولکولی |  | 
| تراکم | 1.18g/cm3 | 
| نقطه ذوب | 39-41℃ | 
| نقطه غلیان | 292°C at 760 mmHg | 
| ضریب شکست | 1.528 | 
| نقطه اشتعال | 122.4°C | 
| فشار بخار | 0.00108mmHg at 25°C | 
| توضیحات ایمنی | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |