ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 617-05-0 Vanilicacidethylester; 97% | |
| 상품명칭 | Vanilicacidethylester; 97% | 
| 영문 이름 | Vanilicacidethylester; 97%;Vanilic acid ethyl ester;Ethyl vanillate;Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester;4-Hydroxy-3-methoxybenzoic acid ethyl ester;ethyl 4-hydroxy-3-methoxybenzoate | 
| 분자식 | C10H12O4 | 
| 분자량 | 196.1999 | 
| InChI | InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 | 
| cas번호 | 617-05-0 | 
| EC번호 | 210-503-9 | 
| 분자 구조 |  | 
| 밀도 | 1.18g/cm3 | 
| 녹는 점 | 39-41℃ | 
| 비등점 | 292°C at 760 mmHg | 
| 굴절 지수 | 1.528 | 
| 인화점 | 122.4°C | 
| 증기압 | 0.00108mmHg at 25°C | 
| 보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |