ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 617-05-0 Vanilicacidethylester; 97% | |
| Nome do produto | Vanilicacidethylester; 97% | 
| Nome em inglês | Vanilicacidethylester; 97%;Vanilic acid ethyl ester;Ethyl vanillate;Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester;4-Hydroxy-3-methoxybenzoic acid ethyl ester;ethyl 4-hydroxy-3-methoxybenzoate | 
| Fórmula molecular | C10H12O4 | 
| Peso Molecular | 196.1999 | 
| InChI | InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 | 
| CAS Registry Number | 617-05-0 | 
| EINECS | 210-503-9 | 
| Estrutura Molecular |  | 
| Densidade | 1.18g/cm3 | 
| Ponto de fusão | 39-41℃ | 
| Ponto de ebulição | 292°C at 760 mmHg | 
| índice de refração | 1.528 | 
| O ponto de inflamação | 122.4°C | 
| Pressão de vapor | 0.00108mmHg at 25°C | 
| Descrição da Segurança | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |