ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-30-0 trans-Stilbene |
|
| Nome del prodotto | trans-Stilbene |
| Nome inglese | trans-Stilbene;trans-1,1-(1,2-Ethenediyl)bis(benzene);1,1'-ethene-1,1-diyldibenzene;1,1'-(E)-ethene-1,2-diyldibenzene;1,1'-(Z)-ethene-1,2-diyldibenzene |
| Formula molecolare | C14H12 |
| Peso Molecolare | 180.2451 |
| InChI | InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| Numero CAS | 103-30-0 |
| EINECS | 203-098-5 |
| Struttura molecolare | ![]() |
| Densità | 1.044g/cm3 |
| Punto di fusione | 122-126℃ |
| Punto di ebollizione | 307°C at 760 mmHg |
| Indice di rifrazione | 1.658 |
| Punto d'infiammabilità | 128.5°C |
| Pressione di vapore | 0.00135mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |